C18H17N3O3 — CID 25340888
N-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]-1,3-benzodioxol-5-amine (PubChem CID 25340888) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 25340888 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(1S)-1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1ccc(-c2nnc([C@H](C)Nc3ccc4c(c3)OCO4)o2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-3-5-13(6-4-11)18-21-20-17(24-18)12(2)19-14-7-8-15-16(9-14)23-10-22-15/h3-9,12,19H,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | QMEDABHFBYYKQN-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|