C17H19NO2 — CID 43196985
N-[1-(2,4-dimethylphenyl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 43196985) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43196985 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1ccc(C(C)Nc2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C17H19NO2/c1-11-4-6-15(12(2)8-11)13(3)18-14-5-7-16-17(9-14)20-10-19-16/h4-9,13,18H,10H2,1-3H3 |
| InChIKey | NQCWAKVHEIQHDG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|