C16H18ClN — CID 43097496
4-chloro-N-[1-(2,4-dimethylphenyl)ethyl]aniline (PubChem CID 43097496) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-chloro-N-[1-(2,4-dimethylphenyl)ethyl]aniline.
| Compound Name | 4-chloro-N-[1-(2,4-dimethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43097496 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-chloro-N-[1-(2,4-dimethylphenyl)ethyl]aniline |
| SMILES | Cc1ccc(C(C)Nc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C16H18ClN/c1-11-4-9-16(12(2)10-11)13(3)18-15-7-5-14(17)6-8-15/h4-10,13,18H,1-3H3 |
| InChIKey | PZFPSUFGMPSHKR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |