C14H15NO2S — CID 63992421
N-[1-(3-methylthiophen-2-yl)ethyl]-1,3-benzodioxol-5-amine (PubChem CID 63992421) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[1-(3-methylthiophen-2-yl)ethyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[1-(3-methylthiophen-2-yl)ethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63992421 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-[1-(3-methylthiophen-2-yl)ethyl]-1,3-benzodioxol-5-amine |
| SMILES | Cc1ccsc1C(C)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15NO2S/c1-9-5-6-18-14(9)10(2)15-11-3-4-12-13(7-11)17-8-16-12/h3-7,10,15H,8H2,1-2H3 |
| InChIKey | GWIARNZGZJIQAQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|