C18H24N2S — CID 63992461
N-[1-(3-methylthiophen-2-yl)ethyl]-4-piperidin-1-ylaniline (PubChem CID 63992461) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is N-[1-(3-methylthiophen-2-yl)ethyl]-4-piperidin-1-ylaniline.
| Compound Name | N-[1-(3-methylthiophen-2-yl)ethyl]-4-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 63992461 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[1-(3-methylthiophen-2-yl)ethyl]-4-piperidin-1-ylaniline |
| SMILES | Cc1ccsc1C(C)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2S/c1-14-10-13-21-18(14)15(2)19-16-6-8-17(9-7-16)20-11-4-3-5-12-20/h6-10,13,15,19H,3-5,11-12H2,1-2H3 |
| InChIKey | FMTAWSSAKZAGEG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|