C17H20N2OS — CID 63992626
1-[3-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]pyrrolidin-2-one (PubChem CID 63992626) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-[3-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 63992626 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[3-[1-(3-methylthiophen-2-yl)ethylamino]phenyl]pyrrolidin-2-one |
| SMILES | Cc1ccsc1C(C)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C17H20N2OS/c1-12-8-10-21-17(12)13(2)18-14-5-3-6-15(11-14)19-9-4-7-16(19)20/h3,5-6,8,10-11,13,18H,4,7,9H2,1-2H3 |
| InChIKey | VRQIWLQRUALFAM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |