C15H17N3OS — CID 115917295
1-[3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]pyrrolidin-2-one (PubChem CID 115917295) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-[3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 115917295 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-[3-[1-(1,3-thiazol-5-yl)ethylamino]phenyl]pyrrolidin-2-one |
| SMILES | CC(Nc1cccc(N2CCCC2=O)c1)c1cncs1 |
| InChI | InChI=1S/C15H17N3OS/c1-11(14-9-16-10-20-14)17-12-4-2-5-13(8-12)18-7-3-6-15(18)19/h2,4-5,8-11,17H,3,6-7H2,1H3 |
| InChIKey | YGKGBGQJRMWHFC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |