C18H16N4O3 — CID 32968497
6-[[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]-4H-1,4-benzoxazin-3-one (PubChem CID 32968497) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 6-[[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 32968497 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 6-[[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]amino]-4H-1,4-benzoxazin-3-one |
| SMILES | C[C@@H](Nc1ccc2c(c1)NC(=O)CO2)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H16N4O3/c1-11(17-21-22-18(25-17)12-5-3-2-4-6-12)19-13-7-8-15-14(9-13)20-16(23)10-24-15/h2-9,11,19H,10H2,1H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | XQGLVSJXSUKHDG-LLVKDONJSA-N |
| XLogP | 3.24 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|