C20H22N4O4 — CID 60542358
2-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenoxy]acetamide (PubChem CID 60542358) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 60542358 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenoxy]acetamide |
| SMILES | COc1ccc(NC(C)c2nnc(-c3ccc(C)cc3)o2)cc1OCC(N)=O |
| InChI | InChI=1S/C20H22N4O4/c1-12-4-6-14(7-5-12)20-24-23-19(28-20)13(2)22-15-8-9-16(26-3)17(10-15)27-11-18(21)25/h4-10,13,22H,11H2,1-3H3,(H2,21,25) |
| InChIKey | WBBHWNMLWXZPDH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|