C20H25N3O4 — CID 47065312
2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-(2,6-dimethylphenyl)propanamide (PubChem CID 47065312) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-(2,6-dimethylphenyl)propanamide.
| Compound Name | 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-(2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 47065312 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-(2,6-dimethylphenyl)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2c(C)cccc2C)cc1OCC(N)=O |
| InChI | InChI=1S/C20H25N3O4/c1-12-6-5-7-13(2)19(12)23-20(25)14(3)22-15-8-9-16(26-4)17(10-15)27-11-18(21)24/h5-10,14,22H,11H2,1-4H3,(H2,21,24)(H,23,25) |
| InChIKey | NQWUWUJNUGPSFB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|