C21H22N4O4 — CID 55914859
2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-quinolin-5-ylpropanamide (PubChem CID 55914859) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-quinolin-5-ylpropanamide.
| Compound Name | 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-quinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 55914859 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-N-quinolin-5-ylpropanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2cccc3ncccc23)cc1OCC(N)=O |
| InChI | InChI=1S/C21H22N4O4/c1-13(21(27)25-17-7-3-6-16-15(17)5-4-10-23-16)24-14-8-9-18(28-2)19(11-14)29-12-20(22)26/h3-11,13,24H,12H2,1-2H3,(H2,22,26)(H,25,27) |
| InChIKey | LQKZLXAADDBGRY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|