C17H18F2N2O3 — CID 56805403
2-[5-[1-(2,6-difluorophenyl)ethylamino]-2-methoxyphenoxy]acetamide (PubChem CID 56805403) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[5-[1-(2,6-difluorophenyl)ethylamino]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[5-[1-(2,6-difluorophenyl)ethylamino]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 56805403 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[5-[1-(2,6-difluorophenyl)ethylamino]-2-methoxyphenoxy]acetamide |
| SMILES | COc1ccc(NC(C)c2c(F)cccc2F)cc1OCC(N)=O |
| InChI | InChI=1S/C17H18F2N2O3/c1-10(17-12(18)4-3-5-13(17)19)21-11-6-7-14(23-2)15(8-11)24-9-16(20)22/h3-8,10,21H,9H2,1-2H3,(H2,20,22) |
| InChIKey | PXPYSIAHSZCAFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|