C22H21N2O2+ — CID 9441387
[(1S)-1-(furan-2-yl)ethyl]-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium (PubChem CID 9441387) has the molecular formula C22H21N2O2+ and a molecular weight of 345.42 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)ethyl]-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium.
| Compound Name | [(1S)-1-(furan-2-yl)ethyl]-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9441387 |
| Molecular Formula | C22H21N2O2+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(1S)-1-(furan-2-yl)ethyl]-[(1R)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+][C@@H](C(=O)c1c[nH]c2ccccc12)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H20N2O2/c1-15(20-12-7-13-26-20)24-21(16-8-3-2-4-9-16)22(25)18-14-23-19-11-6-5-10-17(18)19/h2-15,21,23-24H,1H3/p+1/t15-,21+/m0/s1 |
| InChIKey | YDKPHNVMKDQZSQ-YCRPNKLZSA-O |
| XLogP | 4.01 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |