C25H22FN2O2+ — CID 8755427
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755427) has the molecular formula C25H22FN2O2+ and a molecular weight of 401.46 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755427 |
| Molecular Formula | C25H22FN2O2+ |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(Nc1ccc(F)cc1)[C@H]([NH2+][C@H](c1ccccc1)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C25H21FN2O2/c26-20-13-15-21(16-14-20)27-25(29)24(19-10-5-2-6-11-19)28-23(22-12-7-17-30-22)18-8-3-1-4-9-18/h1-17,23-24,28H,(H,27,29)/p+1/t23-,24-/m1/s1 |
| InChIKey | ZDXREOLBNTVQSS-DNQXCXABSA-O |
| XLogP | 4.45 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |