C22H23N2O2+ — CID 8756137
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8756137) has the molecular formula C22H23N2O2+ and a molecular weight of 347.44 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8756137 |
| Molecular Formula | C22H23N2O2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(NC1CC1)[C@H]([NH2+][C@H](c1ccccc1)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-22(23-18-13-14-18)21(17-10-5-2-6-11-17)24-20(19-12-7-15-26-19)16-8-3-1-4-9-16/h1-12,15,18,20-21,24H,13-14H2,(H,23,25)/p+1/t20-,21-/m1/s1 |
| InChIKey | ZDKDGKYFCXLKJX-NHCUHLMSSA-O |
| XLogP | 2.95 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |