C22H22N2O2 — CID 8756132
(2S)-N-cyclopropyl-2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-phenylacetamide (PubChem CID 8756132) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-phenylacetamide.
| Compound Name | (2S)-N-cyclopropyl-2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 8756132 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-phenylacetamide |
| SMILES | O=C(NC1CC1)[C@@H](N[C@@H](c1ccccc1)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-22(23-18-13-14-18)21(17-10-5-2-6-11-17)24-20(19-12-7-15-26-19)16-8-3-1-4-9-16/h1-12,15,18,20-21,24H,13-14H2,(H,23,25)/t20-,21-/m0/s1 |
| InChIKey | ZDKDGKYFCXLKJX-SFTDATJTSA-N |
| XLogP | 3.98 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |