C13H20FNO3 — CID 155431279
1-(3,4-dimethoxyphenyl)-2-(2-fluoroethylamino)propan-1-ol (PubChem CID 155431279) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(2-fluoroethylamino)propan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(2-fluoroethylamino)propan-1-ol |
|---|---|
| PubChem CID | 155431279 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(2-fluoroethylamino)propan-1-ol |
| SMILES | COc1ccc(C(O)C(C)NCCF)cc1OC |
| InChI | InChI=1S/C13H20FNO3/c1-9(15-7-6-14)13(16)10-4-5-11(17-2)12(8-10)18-3/h4-5,8-9,13,15-16H,6-7H2,1-3H3 |
| InChIKey | JJCAFAYRIHZLRA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |