C16H27NO3 — CID 82313794
2-(3-ethoxypropylamino)-1-(4-methoxy-3-methylphenyl)propan-1-ol (PubChem CID 82313794) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-1-(4-methoxy-3-methylphenyl)propan-1-ol.
| Compound Name | 2-(3-ethoxypropylamino)-1-(4-methoxy-3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82313794 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-(3-ethoxypropylamino)-1-(4-methoxy-3-methylphenyl)propan-1-ol |
| SMILES | CCOCCCNC(C)C(O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C16H27NO3/c1-5-20-10-6-9-17-13(3)16(18)14-7-8-15(19-4)12(2)11-14/h7-8,11,13,16-18H,5-6,9-10H2,1-4H3 |
| InChIKey | SOMNYBKBCOJYLD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|