C21H16N2O4 — CID 7158722
(2R)-3-hydroxyimino-1-(2-nitrophenyl)-2,3-diphenylpropan-1-one (PubChem CID 7158722) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is (2R)-3-hydroxyimino-1-(2-nitrophenyl)-2,3-diphenylpropan-1-one.
| Compound Name | (2R)-3-hydroxyimino-1-(2-nitrophenyl)-2,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 7158722 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2R)-3-hydroxyimino-1-(2-nitrophenyl)-2,3-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])[C@@H](C(=NO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N2O4/c24-21(17-13-7-8-14-18(17)23(26)27)19(15-9-3-1-4-10-15)20(22-25)16-11-5-2-6-12-16/h1-14,19,25H/t19-/m1/s1 |
| InChIKey | WRDPBRUEAMOWFT-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|