C24H26O6S2 — CID 160941441
benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-methyl-1-oxo-1-phenylpropan-2-yl) sulfate (PubChem CID 160941441) has the molecular formula C24H26O6S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-methyl-1-oxo-1-phenylpropan-2-yl) sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-methyl-1-oxo-1-phenylpropan-2-yl) sulfate |
|---|---|
| PubChem CID | 160941441 |
| Molecular Formula | C24H26O6S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;(2-methyl-1-oxo-1-phenylpropan-2-yl) sulfate |
| SMILES | CC(C)(OS(=O)(=O)[O-])C(=O)c1ccccc1.C[S+](Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14OS.C10H12O5S/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;1-10(2,15-16(12,13)14)9(11)8-6-4-3-5-7-8/h2-10H,11H2,1H3;3-7H,1-2H3,(H,12,13,14) |
| InChIKey | SUODHIBJCRXSBF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|