C22H24O5S2 — CID 158233410
benzyl-(4-hydroxyphenyl)-methylsulfanium;2-phenylethyl sulfate (PubChem CID 158233410) has the molecular formula C22H24O5S2 and a molecular weight of 432.56 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;2-phenylethyl sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;2-phenylethyl sulfate |
|---|---|
| PubChem CID | 158233410 |
| Molecular Formula | C22H24O5S2 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;2-phenylethyl sulfate |
| SMILES | C[S+](Cc1ccccc1)c1ccc(O)cc1.O=S(=O)([O-])OCCc1ccccc1 |
| InChI | InChI=1S/C14H14OS.C8H10O4S/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;9-13(10,11)12-7-6-8-4-2-1-3-5-8/h2-10H,11H2,1H3;1-5H,6-7H2,(H,9,10,11) |
| InChIKey | GEQVSTSEKYDSLT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|