C25H24O5S2 — CID 161046977
benzyl-(4-hydroxyphenyl)-methylsulfanium;naphthalen-1-ylmethyl sulfate (PubChem CID 161046977) has the molecular formula C25H24O5S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;naphthalen-1-ylmethyl sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;naphthalen-1-ylmethyl sulfate |
|---|---|
| PubChem CID | 161046977 |
| Molecular Formula | C25H24O5S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;naphthalen-1-ylmethyl sulfate |
| SMILES | C[S+](Cc1ccccc1)c1ccc(O)cc1.O=S(=O)([O-])OCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14OS.C11H10O4S/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;12-16(13,14)15-8-10-6-3-5-9-4-1-2-7-11(9)10/h2-10H,11H2,1H3;1-7H,8H2,(H,12,13,14) |
| InChIKey | UBPXGWVOLNATNZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|