C19H20O5S3 — CID 161221700
benzyl-(4-hydroxyphenyl)-methylsulfanium;thiophen-2-ylmethyl sulfate (PubChem CID 161221700) has the molecular formula C19H20O5S3 and a molecular weight of 424.57 g/mol. Its IUPAC name is benzyl-(4-hydroxyphenyl)-methylsulfanium;thiophen-2-ylmethyl sulfate.
| Compound Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;thiophen-2-ylmethyl sulfate |
|---|---|
| PubChem CID | 161221700 |
| Molecular Formula | C19H20O5S3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | benzyl-(4-hydroxyphenyl)-methylsulfanium;thiophen-2-ylmethyl sulfate |
| SMILES | C[S+](Cc1ccccc1)c1ccc(O)cc1.O=S(=O)([O-])OCc1cccs1 |
| InChI | InChI=1S/C14H14OS.C5H6O4S2/c1-16(11-12-5-3-2-4-6-12)14-9-7-13(15)8-10-14;6-11(7,8)9-4-5-2-1-3-10-5/h2-10H,11H2,1H3;1-3H,4H2,(H,6,7,8) |
| InChIKey | UXPGSGBEXFDRMV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|