About O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate
O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate (PubChem CID 173450161) has the molecular formula C12H10O2S2
and a molecular weight of 250.34 g/mol. Its IUPAC name is O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate.
Molecular Properties
| Compound Name | O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate |
| PubChem CID | 173450161 |
| Molecular Formula | C12H10O2S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate |
| SMILES | Oc1ccc(C(=S)OCc2cccs2)cc1 |
| InChI | InChI=1S/C12H10O2S2/c13-10-5-3-9(4-6-10)12(15)14-8-11-2-1-7-16-11/h1-7,13H,8H2 |
| InChIKey | YQLGEEHBUPKKAY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate?
The IUPAC name of O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate (CID 173450161) is O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate.
What is the SMILES notation for O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate?
The canonical SMILES for O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate is Oc1ccc(C(=S)OCc2cccs2)cc1.
What is the InChIKey of O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate?
The InChIKey is YQLGEEHBUPKKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S2/c13-10-5-3-9(4-6-10)12(15)14-8-11-2-1-7-16-11/h1-7,13H,8H2.
What are the key properties of O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate?
O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate has a molecular weight of 250.34 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(thiophen-2-ylmethyl) 4-hydroxybenzenecarbothioate is sourced from PubChem (CID 173450161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).