C22H22O6S2 — CID 157101968
benzyl sulfate;(4-hydroxyphenyl)-methyl-phenacylsulfanium (PubChem CID 157101968) has the molecular formula C22H22O6S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is benzyl sulfate;(4-hydroxyphenyl)-methyl-phenacylsulfanium.
| Compound Name | benzyl sulfate;(4-hydroxyphenyl)-methyl-phenacylsulfanium |
|---|---|
| PubChem CID | 157101968 |
| Molecular Formula | C22H22O6S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | benzyl sulfate;(4-hydroxyphenyl)-methyl-phenacylsulfanium |
| SMILES | C[S+](CC(=O)c1ccccc1)c1ccc(O)cc1.O=S(=O)([O-])OCc1ccccc1 |
| InChI | InChI=1S/C15H14O2S.C7H8O4S/c1-18(14-9-7-13(16)8-10-14)11-15(17)12-5-3-2-4-6-12;8-12(9,10)11-6-7-4-2-1-3-5-7/h2-10H,11H2,1H3;1-5H,6H2,(H,8,9,10) |
| InChIKey | AFWFRNKOHYBKDL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|