C22H30O7S2 — CID 160865690
benzyl-[2-(3-methoxybutoxy)-2-oxoethyl]-methylsulfanium;benzyl sulfate (PubChem CID 160865690) has the molecular formula C22H30O7S2 and a molecular weight of 470.61 g/mol. Its IUPAC name is benzyl-[2-(3-methoxybutoxy)-2-oxoethyl]-methylsulfanium;benzyl sulfate.
| Compound Name | benzyl-[2-(3-methoxybutoxy)-2-oxoethyl]-methylsulfanium;benzyl sulfate |
|---|---|
| PubChem CID | 160865690 |
| Molecular Formula | C22H30O7S2 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | benzyl-[2-(3-methoxybutoxy)-2-oxoethyl]-methylsulfanium;benzyl sulfate |
| SMILES | COC(C)CCOC(=O)C[S+](C)Cc1ccccc1.O=S(=O)([O-])OCc1ccccc1 |
| InChI | InChI=1S/C15H23O3S.C7H8O4S/c1-13(17-2)9-10-18-15(16)12-19(3)11-14-7-5-4-6-8-14;8-12(9,10)11-6-7-4-2-1-3-5-7/h4-8,13H,9-12H2,1-3H3;1-5H,6H2,(H,8,9,10)/q+1;/p-1 |
| InChIKey | SLBYTHUHBUBOCC-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|