C21H20O5S2 — CID 159077011
benzyl sulfate;4-(1,3-dihydro-2-benzothiophen-2-ium-2-yl)phenol (PubChem CID 159077011) has the molecular formula C21H20O5S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is benzyl sulfate;4-(1,3-dihydro-2-benzothiophen-2-ium-2-yl)phenol.
| Compound Name | benzyl sulfate;4-(1,3-dihydro-2-benzothiophen-2-ium-2-yl)phenol |
|---|---|
| PubChem CID | 159077011 |
| Molecular Formula | C21H20O5S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | benzyl sulfate;4-(1,3-dihydro-2-benzothiophen-2-ium-2-yl)phenol |
| SMILES | O=S(=O)([O-])OCc1ccccc1.Oc1ccc([S+]2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C14H12OS.C7H8O4S/c15-13-5-7-14(8-6-13)16-9-11-3-1-2-4-12(11)10-16;8-12(9,10)11-6-7-4-2-1-3-5-7/h1-8H,9-10H2;1-5H,6H2,(H,8,9,10) |
| InChIKey | KAJLWQIAVCSBMV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|