C17H20O6S2 — CID 172680983
benzyl-(4-methoxycarbonyloxyphenyl)-methylsulfanium;methanesulfonate (PubChem CID 172680983) has the molecular formula C17H20O6S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is benzyl-(4-methoxycarbonyloxyphenyl)-methylsulfanium;methanesulfonate.
| Compound Name | benzyl-(4-methoxycarbonyloxyphenyl)-methylsulfanium;methanesulfonate |
|---|---|
| PubChem CID | 172680983 |
| Molecular Formula | C17H20O6S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | benzyl-(4-methoxycarbonyloxyphenyl)-methylsulfanium;methanesulfonate |
| SMILES | COC(=O)Oc1ccc([S+](C)Cc2ccccc2)cc1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H17O3S.CH4O3S/c1-18-16(17)19-14-8-10-15(11-9-14)20(2)12-13-6-4-3-5-7-13;1-5(2,3)4/h3-11H,12H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | AJVVIMPDWDCZBS-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|