C27H39IO4S — CID 159643939
(4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate (PubChem CID 159643939) has the molecular formula C27H39IO4S and a molecular weight of 586.58 g/mol. Its IUPAC name is (4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate.
| Compound Name | (4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate |
|---|---|
| PubChem CID | 159643939 |
| Molecular Formula | C27H39IO4S |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | (4-methylphenyl)-[4-(2-methylpropyl)phenyl]iodanium;(5-methyl-2-propan-2-ylcyclohexyl) sulfate |
| SMILES | CC1CCC(C(C)C)C(OS(=O)(=O)[O-])C1.Cc1ccc([I+]c2ccc(CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C17H20I.C10H20O4S/c1-13(2)12-15-6-10-17(11-7-15)18-16-8-4-14(3)5-9-16;1-7(2)9-5-4-8(3)6-10(9)14-15(11,12)13/h4-11,13H,12H2,1-3H3;7-10H,4-6H2,1-3H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | MQSCTSVPYCQIBS-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|