C22H34O7S — CID 11495943
2-(2-methoxyethoxy)ethyl 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxysulfonylbenzoate (PubChem CID 11495943) has the molecular formula C22H34O7S and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxysulfonylbenzoate.
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxysulfonylbenzoate |
|---|---|
| PubChem CID | 11495943 |
| Molecular Formula | C22H34O7S |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxysulfonylbenzoate |
| SMILES | COCCOCCOC(=O)c1ccccc1S(=O)(=O)O[C@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C22H34O7S/c1-16(2)18-10-9-17(3)15-20(18)29-30(24,25)21-8-6-5-7-19(21)22(23)28-14-13-27-12-11-26-4/h5-8,16-18,20H,9-15H2,1-4H3/t17-,18+,20+/m1/s1 |
| InChIKey | HGBQZILPMLXOEJ-HBFSDRIKSA-N |
| XLogP | 3.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|