C25H42O — CID 101180269
1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynonylbenzene (PubChem CID 101180269) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is 1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynonylbenzene.
| Compound Name | 1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynonylbenzene |
|---|---|
| PubChem CID | 101180269 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | 1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxynonylbenzene |
| SMILES | CCCCCCCCC(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H42O/c1-5-6-7-8-9-13-16-24(22-14-11-10-12-15-22)26-25-19-21(4)17-18-23(25)20(2)3/h10-12,14-15,20-21,23-25H,5-9,13,16-19H2,1-4H3/t21-,23+,24?,25-/m1/s1 |
| InChIKey | PZGZESFJYNBFBX-AMXQZFSZSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|