C26H39NO — CID 11222771
(1S,5R)-3-(1-phenyldecoxy)-8-prop-2-ynyl-8-azabicyclo[3.2.1]octane (PubChem CID 11222771) has the molecular formula C26H39NO and a molecular weight of 381.60 g/mol. Its IUPAC name is (1S,5R)-3-(1-phenyldecoxy)-8-prop-2-ynyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-(1-phenyldecoxy)-8-prop-2-ynyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11222771 |
| Molecular Formula | C26H39NO |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | (1S,5R)-3-(1-phenyldecoxy)-8-prop-2-ynyl-8-azabicyclo[3.2.1]octane |
| SMILES | C#CCN1[C@@H]2CC[C@H]1CC(OC(CCCCCCCCC)c1ccccc1)C2 |
| InChI | InChI=1S/C26H39NO/c1-3-5-6-7-8-9-13-16-26(22-14-11-10-12-15-22)28-25-20-23-17-18-24(21-25)27(23)19-4-2/h2,10-12,14-15,23-26H,3,5-9,13,16-21H2,1H3/t23-,24+,25?,26? |
| InChIKey | PNXCRGSIPXJGMW-JVOXHRMMSA-N |
| XLogP | 6.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|