C27H37NO — CID 11452140
(1R,5S)-8-butyl-3-(1,4-diphenylbutoxy)-8-azabicyclo[3.2.1]octane (PubChem CID 11452140) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is (1R,5S)-8-butyl-3-(1,4-diphenylbutoxy)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-8-butyl-3-(1,4-diphenylbutoxy)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11452140 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | (1R,5S)-8-butyl-3-(1,4-diphenylbutoxy)-8-azabicyclo[3.2.1]octane |
| SMILES | CCCCN1[C@@H]2CC[C@H]1CC(OC(CCCc1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C27H37NO/c1-2-3-19-28-24-17-18-25(28)21-26(20-24)29-27(23-14-8-5-9-15-23)16-10-13-22-11-6-4-7-12-22/h4-9,11-12,14-15,24-27H,2-3,10,13,16-21H2,1H3/t24-,25+,26?,27? |
| InChIKey | PRTHCOUKNKWRQY-HTTSFZEZSA-N |
| XLogP | 6.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |