C32H47NO — CID 11248211
(1S,5R)-8-butyl-3-[(2-octylphenyl)-phenylmethoxy]-8-azabicyclo[3.2.1]octane (PubChem CID 11248211) has the molecular formula C32H47NO and a molecular weight of 461.73 g/mol. Its IUPAC name is (1S,5R)-8-butyl-3-[(2-octylphenyl)-phenylmethoxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-8-butyl-3-[(2-octylphenyl)-phenylmethoxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11248211 |
| Molecular Formula | C32H47NO |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.37 |
| IUPAC Name | (1S,5R)-8-butyl-3-[(2-octylphenyl)-phenylmethoxy]-8-azabicyclo[3.2.1]octane |
| SMILES | CCCCCCCCc1ccccc1C(OC1C[C@H]2CC[C@@H](C1)N2CCCC)c1ccccc1 |
| InChI | InChI=1S/C32H47NO/c1-3-5-7-8-9-11-16-26-17-14-15-20-31(26)32(27-18-12-10-13-19-27)34-30-24-28-21-22-29(25-30)33(28)23-6-4-2/h10,12-15,17-20,28-30,32H,3-9,11,16,21-25H2,1-2H3/t28-,29+,30?,32? |
| InChIKey | FAOJRNDJFDFIQZ-NMYDZTIDSA-N |
| XLogP | 8.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|