C22H29NO4S — CID 8584
(1R,5R)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid (PubChem CID 8584) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is (1R,5R)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid.
| Compound Name | (1R,5R)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid |
|---|---|
| PubChem CID | 8584 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (1R,5R)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid |
| SMILES | CN1[C@@H]2CC[C@@H]1CC(OC(c1ccccc1)c1ccccc1)C2.CS(=O)(=O)O |
| InChI | InChI=1S/C21H25NO.CH4O3S/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;1-5(2,3)4/h2-11,18-21H,12-15H2,1H3;1H3,(H,2,3,4)/t18-,19-;/m1./s1 |
| InChIKey | CPFJLLXFNPCTDW-STYNFMPRSA-N |
| XLogP | 3.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|