C21H23Cl2NO — CID 101101023
3-[(3-chlorophenyl)-(4-chlorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 101101023) has the molecular formula C21H23Cl2NO and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)-(4-chlorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-[(3-chlorophenyl)-(4-chlorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 101101023 |
| Molecular Formula | C21H23Cl2NO |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-[(3-chlorophenyl)-(4-chlorophenyl)methoxy]-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1C2CCC1CC(OC(c1ccc(Cl)cc1)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C21H23Cl2NO/c1-24-18-9-10-19(24)13-20(12-18)25-21(14-5-7-16(22)8-6-14)15-3-2-4-17(23)11-15/h2-8,11,18-21H,9-10,12-13H2,1H3 |
| InChIKey | YYGLOMNQINXGRR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |