C17H23NO — CID 11777243
(1R,5S)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 11777243) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (1R,5S)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5S)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 11777243 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (1R,5S)-8-(4-phenylbutyl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1C[C@H]2CC[C@@H](C1)N2CCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NO/c19-17-12-15-9-10-16(13-17)18(15)11-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,15-16H,4-5,8-13H2/t15-,16+ |
| InChIKey | QWBZCGIFRAFUJF-IYBDPMFKSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|