C19H29IO — CID 114772958
1-[2-iodo-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]-2-methylbenzene (PubChem CID 114772958) has the molecular formula C19H29IO and a molecular weight of 400.34 g/mol. Its IUPAC name is 1-[2-iodo-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]-2-methylbenzene.
| Compound Name | 1-[2-iodo-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 114772958 |
| Molecular Formula | C19H29IO |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-[2-iodo-1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethyl]-2-methylbenzene |
| SMILES | Cc1ccccc1C(CI)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C19H29IO/c1-13(2)16-10-9-14(3)11-18(16)21-19(12-20)17-8-6-5-7-15(17)4/h5-8,13-14,16,18-19H,9-12H2,1-4H3 |
| InChIKey | GLSFBBCMQADHCE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|