C16H23IO — CID 114773988
1-[1-(cyclohexylmethoxy)-2-iodoethyl]-2-methylbenzene (PubChem CID 114773988) has the molecular formula C16H23IO and a molecular weight of 358.26 g/mol. Its IUPAC name is 1-[1-(cyclohexylmethoxy)-2-iodoethyl]-2-methylbenzene.
| Compound Name | 1-[1-(cyclohexylmethoxy)-2-iodoethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 114773988 |
| Molecular Formula | C16H23IO |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-[1-(cyclohexylmethoxy)-2-iodoethyl]-2-methylbenzene |
| SMILES | Cc1ccccc1C(CI)OCC1CCCCC1 |
| InChI | InChI=1S/C16H23IO/c1-13-7-5-6-10-15(13)16(11-17)18-12-14-8-3-2-4-9-14/h5-7,10,14,16H,2-4,8-9,11-12H2,1H3 |
| InChIKey | SAXGUIWXBVMALT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|