C16H23IO2 — CID 114775056
4-[2-iodo-1-(2-methylphenyl)ethoxy]-2,6-dimethyloxane (PubChem CID 114775056) has the molecular formula C16H23IO2 and a molecular weight of 374.26 g/mol. Its IUPAC name is 4-[2-iodo-1-(2-methylphenyl)ethoxy]-2,6-dimethyloxane.
| Compound Name | 4-[2-iodo-1-(2-methylphenyl)ethoxy]-2,6-dimethyloxane |
|---|---|
| PubChem CID | 114775056 |
| Molecular Formula | C16H23IO2 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-[2-iodo-1-(2-methylphenyl)ethoxy]-2,6-dimethyloxane |
| SMILES | Cc1ccccc1C(CI)OC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H23IO2/c1-11-6-4-5-7-15(11)16(10-17)19-14-8-12(2)18-13(3)9-14/h4-7,12-14,16H,8-10H2,1-3H3 |
| InChIKey | DDQGLXCNVOGBNE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|