C15H26O3 — CID 101035374
(1S,2R,4R)-2-(1-hydroperoxy-2-methylidenebut-3-enoxy)-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 101035374) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2R,4R)-2-(1-hydroperoxy-2-methylidenebut-3-enoxy)-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-(1-hydroperoxy-2-methylidenebut-3-enoxy)-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 101035374 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2R,4R)-2-(1-hydroperoxy-2-methylidenebut-3-enoxy)-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C=CC(=C)C(OO)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C15H26O3/c1-6-12(5)15(18-16)17-14-9-11(4)7-8-13(14)10(2)3/h6,10-11,13-16H,1,5,7-9H2,2-4H3/t11-,13+,14-,15?/m1/s1 |
| InChIKey | CLUXIDFMVDPYHM-BMGQEUAGSA-N |
| XLogP | 4.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|