C18H38O6 — CID 21312410
2,5-dihydroperoxy-2,5-dimethylhexane;2-hydroperoxy-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 21312410) has the molecular formula C18H38O6 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2,5-dihydroperoxy-2,5-dimethylhexane;2-hydroperoxy-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | 2,5-dihydroperoxy-2,5-dimethylhexane;2-hydroperoxy-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 21312410 |
| Molecular Formula | C18H38O6 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2,5-dihydroperoxy-2,5-dimethylhexane;2-hydroperoxy-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)(CCC(C)(C)OO)OO.CC1CCC(C(C)C)C(OO)C1 |
| InChI | InChI=1S/C10H20O2.C8H18O4/c1-7(2)9-5-4-8(3)6-10(9)12-11;1-7(2,11-9)5-6-8(3,4)12-10/h7-11H,4-6H2,1-3H3;9-10H,5-6H2,1-4H3 |
| InChIKey | UZFHNCGUJUIPAX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|