C12H24O3 — CID 143659959
1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethane-1,1-diol (PubChem CID 143659959) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethane-1,1-diol.
| Compound Name | 1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethane-1,1-diol |
|---|---|
| PubChem CID | 143659959 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 1-(5-methyl-2-propan-2-ylcyclohexyl)oxyethane-1,1-diol |
| SMILES | CC1CCC(C(C)C)C(OC(C)(O)O)C1 |
| InChI | InChI=1S/C12H24O3/c1-8(2)10-6-5-9(3)7-11(10)15-12(4,13)14/h8-11,13-14H,5-7H2,1-4H3 |
| InChIKey | GQSZOGGCRCNGRT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|