C22H44O3Si — CID 173404047
1,1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]ethoxysilane (PubChem CID 173404047) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is 1,1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]ethoxysilane.
| Compound Name | 1,1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]ethoxysilane |
|---|---|
| PubChem CID | 173404047 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 1,1-bis[(5-methyl-2-propan-2-ylcyclohexyl)oxy]ethoxysilane |
| SMILES | CC1CCC(C(C)C)C(OC(C)(O[SiH3])OC2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C22H44O3Si/c1-14(2)18-10-8-16(5)12-20(18)23-22(7,25-26)24-21-13-17(6)9-11-19(21)15(3)4/h14-21H,8-13H2,1-7,26H3 |
| InChIKey | DWXOSZIPTIDHPZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|