C29H52O4 — CID 141416838
methyl 2-cyclohexyl-2,2-bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]acetate (PubChem CID 141416838) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is methyl 2-cyclohexyl-2,2-bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]acetate.
| Compound Name | methyl 2-cyclohexyl-2,2-bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]acetate |
|---|---|
| PubChem CID | 141416838 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | methyl 2-cyclohexyl-2,2-bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]acetate |
| SMILES | COC(=O)C(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C29H52O4/c1-19(2)24-15-13-21(5)17-26(24)32-29(28(30)31-7,23-11-9-8-10-12-23)33-27-18-22(6)14-16-25(27)20(3)4/h19-27H,8-18H2,1-7H3/t21-,22-,24+,25+,26-,27-/m1/s1 |
| InChIKey | AJRJWLCJAKDCDF-NSIOENISSA-N |
| XLogP | 7.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|