C14H25BrO2 — CID 172643840
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromo-2-methylpropanoate (PubChem CID 172643840) has the molecular formula C14H25BrO2 and a molecular weight of 305.26 g/mol. Its IUPAC name is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromo-2-methylpropanoate.
| Compound Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 172643840 |
| Molecular Formula | C14H25BrO2 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C14H25BrO2/c1-9(2)11-7-6-10(3)8-12(11)17-13(16)14(4,5)15/h9-12H,6-8H2,1-5H3/t10-,11?,12-/m1/s1 |
| InChIKey | FNSRLNYDDMNEBS-IGBJHFKCSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|