C15H24Cl4O2 — CID 11036220
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,4,4,4-tetrachloro-2-methylbutanoate (PubChem CID 11036220) has the molecular formula C15H24Cl4O2 and a molecular weight of 378.17 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,4,4,4-tetrachloro-2-methylbutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,4,4,4-tetrachloro-2-methylbutanoate |
|---|---|
| PubChem CID | 11036220 |
| Molecular Formula | C15H24Cl4O2 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2,4,4,4-tetrachloro-2-methylbutanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C(C)(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H24Cl4O2/c1-9(2)11-6-5-10(3)7-12(11)21-13(20)14(4,16)8-15(17,18)19/h9-12H,5-8H2,1-4H3/t10-,11+,12-,14?/m1/s1 |
| InChIKey | GROWCVJIRKDYCC-JIROBOQZSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|