C24H42O5 — CID 163833047
2-[(1R,2S,5R)-2-ethenyl-5-methylcyclohexyl]oxyethyl 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl carbonate (PubChem CID 163833047) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-2-ethenyl-5-methylcyclohexyl]oxyethyl 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl carbonate.
| Compound Name | 2-[(1R,2S,5R)-2-ethenyl-5-methylcyclohexyl]oxyethyl 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl carbonate |
|---|---|
| PubChem CID | 163833047 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 2-[(1R,2S,5R)-2-ethenyl-5-methylcyclohexyl]oxyethyl 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl carbonate |
| SMILES | C=C[C@@H]1CC[C@@H](C)C[C@H]1OCCOC(=O)OCCO[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C24H42O5/c1-6-20-9-7-18(4)15-22(20)26-11-13-28-24(25)29-14-12-27-23-16-19(5)8-10-21(23)17(2)3/h6,17-23H,1,7-16H2,2-5H3/t18-,19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | OFIOKIYJVVJYTI-FHJOOOADSA-N |
| XLogP | 5.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|