C13H23ClO3 — CID 163755542
2-chloroethyl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate (PubChem CID 163755542) has the molecular formula C13H23ClO3 and a molecular weight of 262.78 g/mol. Its IUPAC name is 2-chloroethyl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate.
| Compound Name | 2-chloroethyl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
|---|---|
| PubChem CID | 163755542 |
| Molecular Formula | C13H23ClO3 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-chloroethyl [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)OCCCl |
| InChI | InChI=1S/C13H23ClO3/c1-9(2)11-5-4-10(3)8-12(11)17-13(15)16-7-6-14/h9-12H,4-8H2,1-3H3/t10-,11+,12-/m1/s1 |
| InChIKey | LTSYRZMUYGLSEU-GRYCIOLGSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|