C13H23ClO3 — CID 77355746
1-chloroethyl (5-methyl-2-propan-2-ylcyclohexyl) carbonate (PubChem CID 77355746) has the molecular formula C13H23ClO3 and a molecular weight of 262.78 g/mol. Its IUPAC name is 1-chloroethyl (5-methyl-2-propan-2-ylcyclohexyl) carbonate.
| Compound Name | 1-chloroethyl (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 77355746 |
| Molecular Formula | C13H23ClO3 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-chloroethyl (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)OC(C)Cl)C1 |
| InChI | InChI=1S/C13H23ClO3/c1-8(2)11-6-5-9(3)7-12(11)17-13(15)16-10(4)14/h8-12H,5-7H2,1-4H3 |
| InChIKey | BKDKSAYHHKESAU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|